C13H18N2O2 — CID 54904357
2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)pentanenitrile (PubChem CID 54904357) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)pentanenitrile.
| Compound Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)pentanenitrile |
|---|---|
| PubChem CID | 54904357 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)pentanenitrile |
| SMILES | CCCC(C#N)N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C13H18N2O2/c1-2-5-9(8-14)15-12(16)10-6-3-4-7-11(10)13(15)17/h9-11H,2-7H2,1H3 |
| InChIKey | FRVKRRGHPREBGQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|