About N-(4-cyano-1-methylpiperidin-4-yl)-3,3,3-trifluoropropanamide
N-(4-cyano-1-methylpiperidin-4-yl)-3,3,3-trifluoropropanamide (PubChem CID 54904453) has the molecular formula C10H14F3N3O
and a molecular weight of 249.24 g/mol. Its IUPAC name is N-(4-cyano-1-methylpiperidin-4-yl)-3,3,3-trifluoropropanamide.
Molecular Properties
| Compound Name | N-(4-cyano-1-methylpiperidin-4-yl)-3,3,3-trifluoropropanamide |
| PubChem CID | 54904453 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N-(4-cyano-1-methylpiperidin-4-yl)-3,3,3-trifluoropropanamide |
| SMILES | CN1CCC(C#N)(NC(=O)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H14F3N3O/c1-16-4-2-9(7-14,3-5-16)15-8(17)6-10(11,12)13/h2-6H2,1H3,(H,15,17) |
| InChIKey | YACPUJRUOCJLLE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-cyano-1-methylpiperidin-4-yl)-3,3,3-trifluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyano-1-methylpiperidin-4-yl)-3,3,3-trifluoropropanamide?
The IUPAC name of N-(4-cyano-1-methylpiperidin-4-yl)-3,3,3-trifluoropropanamide (CID 54904453) is N-(4-cyano-1-methylpiperidin-4-yl)-3,3,3-trifluoropropanamide.
What is the SMILES notation for N-(4-cyano-1-methylpiperidin-4-yl)-3,3,3-trifluoropropanamide?
The canonical SMILES for N-(4-cyano-1-methylpiperidin-4-yl)-3,3,3-trifluoropropanamide is CN1CCC(C#N)(NC(=O)CC(F)(F)F)CC1.
What is the InChIKey of N-(4-cyano-1-methylpiperidin-4-yl)-3,3,3-trifluoropropanamide?
The InChIKey is YACPUJRUOCJLLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N3O/c1-16-4-2-9(7-14,3-5-16)15-8(17)6-10(11,12)13/h2-6H2,1H3,(H,15,17).
What are the key properties of N-(4-cyano-1-methylpiperidin-4-yl)-3,3,3-trifluoropropanamide?
N-(4-cyano-1-methylpiperidin-4-yl)-3,3,3-trifluoropropanamide has a molecular weight of 249.24 g/mol, XLogP of 1.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyano-1-methylpiperidin-4-yl)-3,3,3-trifluoropropanamide is sourced from PubChem (CID 54904453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).