C11H15BrFNO2S — CID 54904757
N-[(4-bromo-2-fluorophenyl)methyl]-3-methylsulfonylpropan-1-amine (PubChem CID 54904757) has the molecular formula C11H15BrFNO2S and a molecular weight of 324.22 g/mol. Its IUPAC name is N-[(4-bromo-2-fluorophenyl)methyl]-3-methylsulfonylpropan-1-amine.
| Compound Name | N-[(4-bromo-2-fluorophenyl)methyl]-3-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 54904757 |
| Molecular Formula | C11H15BrFNO2S |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | N-[(4-bromo-2-fluorophenyl)methyl]-3-methylsulfonylpropan-1-amine |
| SMILES | CS(=O)(=O)CCCNCc1ccc(Br)cc1F |
| InChI | InChI=1S/C11H15BrFNO2S/c1-17(15,16)6-2-5-14-8-9-3-4-10(12)7-11(9)13/h3-4,7,14H,2,5-6,8H2,1H3 |
| InChIKey | RTDVBVBYMWKQNK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|