About N-(2-aminocyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide
N-(2-aminocyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 54905155) has the molecular formula C11H16N4O3
and a molecular weight of 252.27 g/mol. Its IUPAC name is N-(2-aminocyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide.
Molecular Properties
| Compound Name | N-(2-aminocyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| PubChem CID | 54905155 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | N-(2-aminocyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | NC1CCCCC1NC(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C11H16N4O3/c12-6-3-1-2-4-7(6)13-10(17)8-5-9(16)15-11(18)14-8/h5-7H,1-4,12H2,(H,13,17)(H2,14,15,16,18) |
| InChIKey | ITBMUDQQZRQLHO-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-aminocyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminocyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide?
The IUPAC name of N-(2-aminocyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide (CID 54905155) is N-(2-aminocyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide.
What is the SMILES notation for N-(2-aminocyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide?
The canonical SMILES for N-(2-aminocyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide is NC1CCCCC1NC(=O)c1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of N-(2-aminocyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide?
The InChIKey is ITBMUDQQZRQLHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O3/c12-6-3-1-2-4-7(6)13-10(17)8-5-9(16)15-11(18)14-8/h5-7H,1-4,12H2,(H,13,17)(H2,14,15,16,18).
What are the key properties of N-(2-aminocyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide?
N-(2-aminocyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide has a molecular weight of 252.27 g/mol, XLogP of -0.94, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminocyclohexyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide is sourced from PubChem (CID 54905155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).