C11H18N4O3 — CID 54906132
6-amino-1-methyl-5-(oxan-3-ylmethylamino)pyrimidine-2,4-dione (PubChem CID 54906132) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 6-amino-1-methyl-5-(oxan-3-ylmethylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-methyl-5-(oxan-3-ylmethylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54906132 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 6-amino-1-methyl-5-(oxan-3-ylmethylamino)pyrimidine-2,4-dione |
| SMILES | Cn1c(N)c(NCC2CCCOC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H18N4O3/c1-15-9(12)8(10(16)14-11(15)17)13-5-7-3-2-4-18-6-7/h7,13H,2-6,12H2,1H3,(H,14,16,17) |
| InChIKey | XVOWAZVKDCMXNG-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |