C15H24N2O2 — CID 54908415
2-(butan-2-ylamino)-2-[4-(dimethylamino)phenyl]propanoic acid (PubChem CID 54908415) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-2-[4-(dimethylamino)phenyl]propanoic acid.
| Compound Name | 2-(butan-2-ylamino)-2-[4-(dimethylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 54908415 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-(butan-2-ylamino)-2-[4-(dimethylamino)phenyl]propanoic acid |
| SMILES | CCC(C)NC(C)(C(=O)O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C15H24N2O2/c1-6-11(2)16-15(3,14(18)19)12-7-9-13(10-8-12)17(4)5/h7-11,16H,6H2,1-5H3,(H,18,19) |
| InChIKey | VQIBNBBBGZDTBD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|