C12H13FN2O2S — CID 54908438
N-(1,4-dioxan-2-ylmethyl)-5-fluoro-1,3-benzothiazol-2-amine (PubChem CID 54908438) has the molecular formula C12H13FN2O2S and a molecular weight of 268.31 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-5-fluoro-1,3-benzothiazol-2-amine.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-5-fluoro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 54908438 |
| Molecular Formula | C12H13FN2O2S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-5-fluoro-1,3-benzothiazol-2-amine |
| SMILES | Fc1ccc2sc(NCC3COCCO3)nc2c1 |
| InChI | InChI=1S/C12H13FN2O2S/c13-8-1-2-11-10(5-8)15-12(18-11)14-6-9-7-16-3-4-17-9/h1-2,5,9H,3-4,6-7H2,(H,14,15) |
| InChIKey | JWQGJCXPCBKNIV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |