C8H14O — CID 549090
1,2,3,3a,4,5,6,6a-octahydropentalen-1-ol (PubChem CID 549090) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a-octahydropentalen-1-ol.
| Compound Name | 1,2,3,3a,4,5,6,6a-octahydropentalen-1-ol |
|---|---|
| PubChem CID | 549090 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a-octahydropentalen-1-ol |
| SMILES | OC1CCC2CCCC12 |
| InChI | InChI=1S/C8H14O/c9-8-5-4-6-2-1-3-7(6)8/h6-9H,1-5H2 |
| InChIKey | AOONMBCPMGBOBG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |