C15H17NO — CID 54909105
3-[(3,5-dimethylphenyl)methoxy]aniline (PubChem CID 54909105) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-[(3,5-dimethylphenyl)methoxy]aniline.
| Compound Name | 3-[(3,5-dimethylphenyl)methoxy]aniline |
|---|---|
| PubChem CID | 54909105 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 3-[(3,5-dimethylphenyl)methoxy]aniline |
| SMILES | Cc1cc(C)cc(COc2cccc(N)c2)c1 |
| InChI | InChI=1S/C15H17NO/c1-11-6-12(2)8-13(7-11)10-17-15-5-3-4-14(16)9-15/h3-9H,10,16H2,1-2H3 |
| InChIKey | RLWFNNJXZDKJAU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|