C14H15N3O — CID 54909301
8-(pyrazin-2-ylmethoxy)-1,2,3,4-tetrahydroquinoline (PubChem CID 54909301) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 8-(pyrazin-2-ylmethoxy)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-(pyrazin-2-ylmethoxy)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 54909301 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 8-(pyrazin-2-ylmethoxy)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1cc2c(c(OCc3cnccn3)c1)NCCC2 |
| InChI | InChI=1S/C14H15N3O/c1-3-11-4-2-6-17-14(11)13(5-1)18-10-12-9-15-7-8-16-12/h1,3,5,7-9,17H,2,4,6,10H2 |
| InChIKey | VGEBGGOZLVWNPD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |