C25H27N3O5 — CID 5490997
2-[(9-hydroxy-2,5,11-trimethyl-6H-pyrido[4,3-b]carbazol-2-ium-10-yl)imino]-3-methylbutanoic acid acetate (PubChem CID 5490997) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-[(9-hydroxy-2,5,11-trimethyl-6H-pyrido[4,3-b]carbazol-2-ium-10-yl)imino]-3-methylbutanoic acid acetate.
| Compound Name | 2-[(9-hydroxy-2,5,11-trimethyl-6H-pyrido[4,3-b]carbazol-2-ium-10-yl)imino]-3-methylbutanoic acid acetate |
|---|---|
| PubChem CID | 5490997 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-[(9-hydroxy-2,5,11-trimethyl-6H-pyrido[4,3-b]carbazol-2-ium-10-yl)imino]-3-methylbutanoic acid acetate |
| SMILES | CC(=O)[O-].Cc1c2cc[n+](C)cc2c(C)c2c1[nH]c1ccc(O)c(/N=C(/C(=O)O)C(C)C)c12 |
| InChI | InChI=1S/C23H23N3O3.C2H4O2/c1-11(2)20(23(28)29)25-22-17(27)7-6-16-19(22)18-12(3)15-10-26(5)9-8-14(15)13(4)21(18)24-16;1-2(3)4/h6-11H,1-5H3,(H2,27,28,29);1H3,(H,3,4)/b25-20+; |
| InChIKey | LIRPDAHQDOITDO-UDLBSFQBSA-N |
| XLogP | 3.19 |
| TPSA | 129.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|