C21H20N3O3+ — CID 5491001
2-[(9-hydroxy-2,5,11-trimethyl-6H-pyrido[4,3-b]carbazol-2-ium-10-yl)imino]propanoic acid (PubChem CID 5491001) has the molecular formula C21H20N3O3+ and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-[(9-hydroxy-2,5,11-trimethyl-6H-pyrido[4,3-b]carbazol-2-ium-10-yl)imino]propanoic acid.
| Compound Name | 2-[(9-hydroxy-2,5,11-trimethyl-6H-pyrido[4,3-b]carbazol-2-ium-10-yl)imino]propanoic acid |
|---|---|
| PubChem CID | 5491001 |
| Molecular Formula | C21H20N3O3+ |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[(9-hydroxy-2,5,11-trimethyl-6H-pyrido[4,3-b]carbazol-2-ium-10-yl)imino]propanoic acid |
| SMILES | C/C(=N\c1c(O)ccc2[nH]c3c(C)c4cc[n+](C)cc4c(C)c3c12)C(=O)O |
| InChI | InChI=1S/C21H19N3O3/c1-10-14-9-24(4)8-7-13(14)11(2)19-17(10)18-15(23-19)5-6-16(25)20(18)22-12(3)21(26)27/h5-9H,1-4H3,(H2,25,26,27)/p+1/b22-12+ |
| InChIKey | BRDFOHCZYLXEGE-WSDLNYQXSA-O |
| XLogP | 3.80 |
| TPSA | 89.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|