About 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenol
4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenol (PubChem CID 54910806) has the molecular formula C14H12N2OS2
and a molecular weight of 288.40 g/mol. Its IUPAC name is 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenol.
Molecular Properties
| Compound Name | 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenol |
| PubChem CID | 54910806 |
| Molecular Formula | C14H12N2OS2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenol |
| SMILES | Cc1sc2ncnc(Sc3ccc(O)cc3)c2c1C |
| InChI | InChI=1S/C14H12N2OS2/c1-8-9(2)18-13-12(8)14(16-7-15-13)19-11-5-3-10(17)4-6-11/h3-7,17H,1-2H3 |
| InChIKey | APCBJCYXGIFHAE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenol?
The IUPAC name of 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenol (CID 54910806) is 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenol.
What is the SMILES notation for 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenol?
The canonical SMILES for 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenol is Cc1sc2ncnc(Sc3ccc(O)cc3)c2c1C.
What is the InChIKey of 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenol?
The InChIKey is APCBJCYXGIFHAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2OS2/c1-8-9(2)18-13-12(8)14(16-7-15-13)19-11-5-3-10(17)4-6-11/h3-7,17H,1-2H3.
What are the key properties of 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenol?
4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenol has a molecular weight of 288.40 g/mol, XLogP of 4.16, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylphenol is sourced from PubChem (CID 54910806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).