C14H13F2N — CID 54911738
1-[3-(3,5-difluorophenyl)phenyl]ethanamine (PubChem CID 54911738) has the molecular formula C14H13F2N and a molecular weight of 233.26 g/mol. Its IUPAC name is 1-[3-(3,5-difluorophenyl)phenyl]ethanamine.
| Compound Name | 1-[3-(3,5-difluorophenyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 54911738 |
| Molecular Formula | C14H13F2N |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 1-[3-(3,5-difluorophenyl)phenyl]ethanamine |
| SMILES | CC(N)c1cccc(-c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C14H13F2N/c1-9(17)10-3-2-4-11(5-10)12-6-13(15)8-14(16)7-12/h2-9H,17H2,1H3 |
| InChIKey | AGBGPNPAHPNPBO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |