About 1-[(4-methyl-1,3-thiazol-2-yl)methylamino]-2,3-dihydro-1H-inden-4-ol
1-[(4-methyl-1,3-thiazol-2-yl)methylamino]-2,3-dihydro-1H-inden-4-ol (PubChem CID 54913172) has the molecular formula C14H16N2OS
and a molecular weight of 260.36 g/mol. Its IUPAC name is 1-[(4-methyl-1,3-thiazol-2-yl)methylamino]-2,3-dihydro-1H-inden-4-ol.
Molecular Properties
| Compound Name | 1-[(4-methyl-1,3-thiazol-2-yl)methylamino]-2,3-dihydro-1H-inden-4-ol |
| PubChem CID | 54913172 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-[(4-methyl-1,3-thiazol-2-yl)methylamino]-2,3-dihydro-1H-inden-4-ol |
| SMILES | Cc1csc(CNC2CCc3c(O)cccc32)n1 |
| InChI | InChI=1S/C14H16N2OS/c1-9-8-18-14(16-9)7-15-12-6-5-11-10(12)3-2-4-13(11)17/h2-4,8,12,15,17H,5-7H2,1H3 |
| InChIKey | BMGFHHSCQLVFEO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4-methyl-1,3-thiazol-2-yl)methylamino]-2,3-dihydro-1H-inden-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methyl-1,3-thiazol-2-yl)methylamino]-2,3-dihydro-1H-inden-4-ol?
The IUPAC name of 1-[(4-methyl-1,3-thiazol-2-yl)methylamino]-2,3-dihydro-1H-inden-4-ol (CID 54913172) is 1-[(4-methyl-1,3-thiazol-2-yl)methylamino]-2,3-dihydro-1H-inden-4-ol.
What is the SMILES notation for 1-[(4-methyl-1,3-thiazol-2-yl)methylamino]-2,3-dihydro-1H-inden-4-ol?
The canonical SMILES for 1-[(4-methyl-1,3-thiazol-2-yl)methylamino]-2,3-dihydro-1H-inden-4-ol is Cc1csc(CNC2CCc3c(O)cccc32)n1.
What is the InChIKey of 1-[(4-methyl-1,3-thiazol-2-yl)methylamino]-2,3-dihydro-1H-inden-4-ol?
The InChIKey is BMGFHHSCQLVFEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2OS/c1-9-8-18-14(16-9)7-15-12-6-5-11-10(12)3-2-4-13(11)17/h2-4,8,12,15,17H,5-7H2,1H3.
What are the key properties of 1-[(4-methyl-1,3-thiazol-2-yl)methylamino]-2,3-dihydro-1H-inden-4-ol?
1-[(4-methyl-1,3-thiazol-2-yl)methylamino]-2,3-dihydro-1H-inden-4-ol has a molecular weight of 260.36 g/mol, XLogP of 2.93, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methyl-1,3-thiazol-2-yl)methylamino]-2,3-dihydro-1H-inden-4-ol is sourced from PubChem (CID 54913172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).