C12H14F3NO2 — CID 54913202
3,3,3-trifluoro-N-[1-(2-hydroxyphenyl)ethyl]-N-methylpropanamide (PubChem CID 54913202) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[1-(2-hydroxyphenyl)ethyl]-N-methylpropanamide.
| Compound Name | 3,3,3-trifluoro-N-[1-(2-hydroxyphenyl)ethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 54913202 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3,3,3-trifluoro-N-[1-(2-hydroxyphenyl)ethyl]-N-methylpropanamide |
| SMILES | CC(c1ccccc1O)N(C)C(=O)CC(F)(F)F |
| InChI | InChI=1S/C12H14F3NO2/c1-8(9-5-3-4-6-10(9)17)16(2)11(18)7-12(13,14)15/h3-6,8,17H,7H2,1-2H3 |
| InChIKey | URBVHLKVLIDGND-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|