About 4-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-1-ethylpyrrole-2-carboxamide
4-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-1-ethylpyrrole-2-carboxamide (PubChem CID 54914323) has the molecular formula C12H17BrN2O3S
and a molecular weight of 349.25 g/mol. Its IUPAC name is 4-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-1-ethylpyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-1-ethylpyrrole-2-carboxamide |
| PubChem CID | 54914323 |
| Molecular Formula | C12H17BrN2O3S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 4-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H17BrN2O3S/c1-2-15-7-10(13)5-11(15)12(16)14-6-9-3-4-19(17,18)8-9/h5,7,9H,2-4,6,8H2,1H3,(H,14,16) |
| InChIKey | UVUBSQMKKWKOPV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-1-ethylpyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-1-ethylpyrrole-2-carboxamide?
The IUPAC name of 4-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-1-ethylpyrrole-2-carboxamide (CID 54914323) is 4-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-1-ethylpyrrole-2-carboxamide.
What is the SMILES notation for 4-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-1-ethylpyrrole-2-carboxamide?
The canonical SMILES for 4-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-1-ethylpyrrole-2-carboxamide is CCn1cc(Br)cc1C(=O)NCC1CCS(=O)(=O)C1.
What is the InChIKey of 4-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-1-ethylpyrrole-2-carboxamide?
The InChIKey is UVUBSQMKKWKOPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrN2O3S/c1-2-15-7-10(13)5-11(15)12(16)14-6-9-3-4-19(17,18)8-9/h5,7,9H,2-4,6,8H2,1H3,(H,14,16).
What are the key properties of 4-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-1-ethylpyrrole-2-carboxamide?
4-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-1-ethylpyrrole-2-carboxamide has a molecular weight of 349.25 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-1-ethylpyrrole-2-carboxamide is sourced from PubChem (CID 54914323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).