About 1-(1,1-dioxothiolan-3-yl)-3,3-dimethyl-N-propylbutan-2-amine
1-(1,1-dioxothiolan-3-yl)-3,3-dimethyl-N-propylbutan-2-amine (PubChem CID 54914609) has the molecular formula C13H27NO2S
and a molecular weight of 261.43 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3,3-dimethyl-N-propylbutan-2-amine.
Molecular Properties
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3,3-dimethyl-N-propylbutan-2-amine |
| PubChem CID | 54914609 |
| Molecular Formula | C13H27NO2S |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3,3-dimethyl-N-propylbutan-2-amine |
| SMILES | CCCNC(CC1CCS(=O)(=O)C1)C(C)(C)C |
| InChI | InChI=1S/C13H27NO2S/c1-5-7-14-12(13(2,3)4)9-11-6-8-17(15,16)10-11/h11-12,14H,5-10H2,1-4H3 |
| InChIKey | AMYLJLZEYUQMNB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,1-dioxothiolan-3-yl)-3,3-dimethyl-N-propylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothiolan-3-yl)-3,3-dimethyl-N-propylbutan-2-amine?
The IUPAC name of 1-(1,1-dioxothiolan-3-yl)-3,3-dimethyl-N-propylbutan-2-amine (CID 54914609) is 1-(1,1-dioxothiolan-3-yl)-3,3-dimethyl-N-propylbutan-2-amine.
What is the SMILES notation for 1-(1,1-dioxothiolan-3-yl)-3,3-dimethyl-N-propylbutan-2-amine?
The canonical SMILES for 1-(1,1-dioxothiolan-3-yl)-3,3-dimethyl-N-propylbutan-2-amine is CCCNC(CC1CCS(=O)(=O)C1)C(C)(C)C.
What is the InChIKey of 1-(1,1-dioxothiolan-3-yl)-3,3-dimethyl-N-propylbutan-2-amine?
The InChIKey is AMYLJLZEYUQMNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2S/c1-5-7-14-12(13(2,3)4)9-11-6-8-17(15,16)10-11/h11-12,14H,5-10H2,1-4H3.
What are the key properties of 1-(1,1-dioxothiolan-3-yl)-3,3-dimethyl-N-propylbutan-2-amine?
1-(1,1-dioxothiolan-3-yl)-3,3-dimethyl-N-propylbutan-2-amine has a molecular weight of 261.43 g/mol, XLogP of 2.23, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothiolan-3-yl)-3,3-dimethyl-N-propylbutan-2-amine is sourced from PubChem (CID 54914609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).