C26H26NO6- — CID 5491586
[(4R,4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate benzoate (PubChem CID 5491586) has the molecular formula C26H26NO6- and a molecular weight of 448.50 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate benzoate.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate benzoate |
|---|---|
| PubChem CID | 5491586 |
| Molecular Formula | C26H26NO6- |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate benzoate |
| SMILES | CC(=O)Oc1ccc2c3c1O[C@H]1[C@@H](O)C=C[C@H]4[C@@H](C2)N(C)CC[C@@]341.O=C([O-])c1ccccc1 |
| InChI | InChI=1S/C19H21NO4.C7H6O2/c1-10(21)23-15-6-3-11-9-13-12-4-5-14(22)18-19(12,7-8-20(13)2)16(11)17(15)24-18;8-7(9)6-4-2-1-3-5-6/h3-6,12-14,18,22H,7-9H2,1-2H3;1-5H,(H,8,9)/p-1/t12-,13+,14-,18-,19-;/m0./s1 |
| InChIKey | HVQZXZISQHHIDZ-YZZSNFJZSA-M |
| XLogP | 1.47 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|