About N-(3-hydroxypropyl)-4,6-dimethyl-2-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide
N-(3-hydroxypropyl)-4,6-dimethyl-2-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide (PubChem CID 54916287) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-4,6-dimethyl-2-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-(3-hydroxypropyl)-4,6-dimethyl-2-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide |
| PubChem CID | 54916287 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N-(3-hydroxypropyl)-4,6-dimethyl-2-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(C)c(C(=O)N(CCCO)C(C)C)c(=O)[nH]1 |
| InChI | InChI=1S/C14H22N2O3/c1-9(2)16(6-5-7-17)14(19)12-10(3)8-11(4)15-13(12)18/h8-9,17H,5-7H2,1-4H3,(H,15,18) |
| InChIKey | VDKGWVZSFJVIFQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-hydroxypropyl)-4,6-dimethyl-2-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxypropyl)-4,6-dimethyl-2-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide?
The IUPAC name of N-(3-hydroxypropyl)-4,6-dimethyl-2-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide (CID 54916287) is N-(3-hydroxypropyl)-4,6-dimethyl-2-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide.
What is the SMILES notation for N-(3-hydroxypropyl)-4,6-dimethyl-2-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide?
The canonical SMILES for N-(3-hydroxypropyl)-4,6-dimethyl-2-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide is Cc1cc(C)c(C(=O)N(CCCO)C(C)C)c(=O)[nH]1.
What is the InChIKey of N-(3-hydroxypropyl)-4,6-dimethyl-2-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide?
The InChIKey is VDKGWVZSFJVIFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3/c1-9(2)16(6-5-7-17)14(19)12-10(3)8-11(4)15-13(12)18/h8-9,17H,5-7H2,1-4H3,(H,15,18).
What are the key properties of N-(3-hydroxypropyl)-4,6-dimethyl-2-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide?
N-(3-hydroxypropyl)-4,6-dimethyl-2-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide has a molecular weight of 266.34 g/mol, XLogP of 1.22, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxypropyl)-4,6-dimethyl-2-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide is sourced from PubChem (CID 54916287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).