About N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-sulfonamide
N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-sulfonamide (PubChem CID 54916390) has the molecular formula C10H17N3O5S
and a molecular weight of 291.33 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-sulfonamide |
| PubChem CID | 54916390 |
| Molecular Formula | C10H17N3O5S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-sulfonamide |
| SMILES | CC(C)N(CCCO)S(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H17N3O5S/c1-7(2)13(4-3-5-14)19(17,18)8-6-11-10(16)12-9(8)15/h6-7,14H,3-5H2,1-2H3,(H2,11,12,15,16) |
| InChIKey | YBCDSSQOZSRDCR-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-sulfonamide?
The IUPAC name of N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-sulfonamide (CID 54916390) is N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-sulfonamide.
What is the SMILES notation for N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-sulfonamide?
The canonical SMILES for N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-sulfonamide is CC(C)N(CCCO)S(=O)(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-sulfonamide?
The InChIKey is YBCDSSQOZSRDCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O5S/c1-7(2)13(4-3-5-14)19(17,18)8-6-11-10(16)12-9(8)15/h6-7,14H,3-5H2,1-2H3,(H2,11,12,15,16).
What are the key properties of N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-sulfonamide?
N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-sulfonamide has a molecular weight of 291.33 g/mol, XLogP of -1.16, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-sulfonamide is sourced from PubChem (CID 54916390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).