About 1,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one
1,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one (PubChem CID 5491648) has the molecular formula C15H8O6
and a molecular weight of 284.22 g/mol. Its IUPAC name is 1,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one.
Molecular Properties
| Compound Name | 1,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one |
| PubChem CID | 5491648 |
| Molecular Formula | C15H8O6 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 1,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one |
| SMILES | O=c1oc2cc(O)cc(O)c2c2oc3cc(O)ccc3c12 |
| InChI | InChI=1S/C15H8O6/c16-6-1-2-8-10(4-6)20-14-12(8)15(19)21-11-5-7(17)3-9(18)13(11)14/h1-5,16-18H |
| InChIKey | WIRRQLQRDSREEG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 1,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one?
The IUPAC name of 1,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one (CID 5491648) is 1,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one.
What is the SMILES notation for 1,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one?
The canonical SMILES for 1,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one is O=c1oc2cc(O)cc(O)c2c2oc3cc(O)ccc3c12.
What is the InChIKey of 1,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one?
The InChIKey is WIRRQLQRDSREEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8O6/c16-6-1-2-8-10(4-6)20-14-12(8)15(19)21-11-5-7(17)3-9(18)13(11)14/h1-5,16-18H.
What are the key properties of 1,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one?
1,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one has a molecular weight of 284.22 g/mol, XLogP of 2.81, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one is sourced from PubChem (CID 5491648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).