About N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-carboxamide
N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-carboxamide (PubChem CID 54916721) has the molecular formula C11H17N3O4
and a molecular weight of 255.27 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-carboxamide |
| PubChem CID | 54916721 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-carboxamide |
| SMILES | CC(C)N(CCCO)C(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H17N3O4/c1-7(2)14(4-3-5-15)10(17)8-6-12-11(18)13-9(8)16/h6-7,15H,3-5H2,1-2H3,(H2,12,13,16,18) |
| InChIKey | QISZXMQVAKAJMK-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-carboxamide?
The IUPAC name of N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-carboxamide (CID 54916721) is N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-carboxamide.
What is the SMILES notation for N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-carboxamide?
The canonical SMILES for N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-carboxamide is CC(C)N(CCCO)C(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-carboxamide?
The InChIKey is QISZXMQVAKAJMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O4/c1-7(2)14(4-3-5-15)10(17)8-6-12-11(18)13-9(8)16/h6-7,15H,3-5H2,1-2H3,(H2,12,13,16,18).
What are the key properties of N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-carboxamide?
N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-carboxamide has a molecular weight of 255.27 g/mol, XLogP of -0.70, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxypropyl)-2,4-dioxo-N-propan-2-yl-1H-pyrimidine-5-carboxamide is sourced from PubChem (CID 54916721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).