C18H28O11S2 — CID 5491756
[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-acetyloxysulfanyl-2-(3-ethylsulfonylpropyl)oxan-3-yl] acetate (PubChem CID 5491756) has the molecular formula C18H28O11S2 and a molecular weight of 484.55 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-acetyloxysulfanyl-2-(3-ethylsulfonylpropyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-acetyloxysulfanyl-2-(3-ethylsulfonylpropyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 5491756 |
| Molecular Formula | C18H28O11S2 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-acetyloxysulfanyl-2-(3-ethylsulfonylpropyl)oxan-3-yl] acetate |
| SMILES | CCS(=O)(=O)CCC[C@H]1O[C@@H](SOC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H28O11S2/c1-6-31(23,24)9-7-8-14-15(25-10(2)19)16(26-11(3)20)17(27-12(4)21)18(28-14)30-29-13(5)22/h14-18H,6-9H2,1-5H3/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | KLTZEVKTLPOZNK-SFFUCWETSA-N |
| XLogP | 0.93 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|