C14H21NO4 — CID 54918350
ethyl 2-(2,3-dimethoxyphenyl)-2-(ethylamino)acetate (PubChem CID 54918350) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is ethyl 2-(2,3-dimethoxyphenyl)-2-(ethylamino)acetate.
| Compound Name | ethyl 2-(2,3-dimethoxyphenyl)-2-(ethylamino)acetate |
|---|---|
| PubChem CID | 54918350 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | ethyl 2-(2,3-dimethoxyphenyl)-2-(ethylamino)acetate |
| SMILES | CCNC(C(=O)OCC)c1cccc(OC)c1OC |
| InChI | InChI=1S/C14H21NO4/c1-5-15-12(14(16)19-6-2)10-8-7-9-11(17-3)13(10)18-4/h7-9,12,15H,5-6H2,1-4H3 |
| InChIKey | YBSQWSJCKLHSIY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |