About N-[4-bromo-2-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine
N-[4-bromo-2-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine (PubChem CID 54918526) has the molecular formula C11H11BrF3NO2S
and a molecular weight of 358.18 g/mol. Its IUPAC name is N-[4-bromo-2-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | N-[4-bromo-2-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine |
| PubChem CID | 54918526 |
| Molecular Formula | C11H11BrF3NO2S |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | N-[4-bromo-2-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CCC(Nc2ccc(Br)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C11H11BrF3NO2S/c12-7-1-2-10(9(5-7)11(13,14)15)16-8-3-4-19(17,18)6-8/h1-2,5,8,16H,3-4,6H2 |
| InChIKey | NODMWXJINURYDV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-bromo-2-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-bromo-2-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine?
The IUPAC name of N-[4-bromo-2-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine (CID 54918526) is N-[4-bromo-2-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine.
What is the SMILES notation for N-[4-bromo-2-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine?
The canonical SMILES for N-[4-bromo-2-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine is O=S1(=O)CCC(Nc2ccc(Br)cc2C(F)(F)F)C1.
What is the InChIKey of N-[4-bromo-2-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine?
The InChIKey is NODMWXJINURYDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrF3NO2S/c12-7-1-2-10(9(5-7)11(13,14)15)16-8-3-4-19(17,18)6-8/h1-2,5,8,16H,3-4,6H2.
What are the key properties of N-[4-bromo-2-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine?
N-[4-bromo-2-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine has a molecular weight of 358.18 g/mol, XLogP of 3.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-bromo-2-(trifluoromethyl)phenyl]-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 54918526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).