About N-hydroxynitramide
N-hydroxynitramide (PubChem CID 5491930) has the molecular formula H2N2O3
and a molecular weight of 78.03 g/mol. Its IUPAC name is N-hydroxynitramide.
Molecular Properties
| Compound Name | N-hydroxynitramide |
| PubChem CID | 5491930 |
| Molecular Formula | H2N2O3 |
| Molecular Weight | 78.03 g/mol |
| Exact Mass | 78.01 |
| IUPAC Name | N-hydroxynitramide |
| SMILES | O=[N+]([O-])NO |
| InChI | InChI=1S/H2N2O3/c3-1-2(4)5/h1,3H |
| InChIKey | BUIMWOLDCCGZKZ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 78.03 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxynitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxynitramide?
The IUPAC name of N-hydroxynitramide (CID 5491930) is N-hydroxynitramide.
What is the SMILES notation for N-hydroxynitramide?
The canonical SMILES for N-hydroxynitramide is O=[N+]([O-])NO.
What is the InChIKey of N-hydroxynitramide?
The InChIKey is BUIMWOLDCCGZKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/H2N2O3/c3-1-2(4)5/h1,3H.
What are the key properties of N-hydroxynitramide?
N-hydroxynitramide has a molecular weight of 78.03 g/mol, XLogP of -0.84, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxynitramide is sourced from PubChem (CID 5491930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).