C10H11N4O7P — CID 5491960
[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]methylphosphonic acid (PubChem CID 5491960) has the molecular formula C10H11N4O7P and a molecular weight of 330.19 g/mol. Its IUPAC name is [(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]methylphosphonic acid.
| Compound Name | [(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]methylphosphonic acid |
|---|---|
| PubChem CID | 5491960 |
| Molecular Formula | C10H11N4O7P |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | [(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]methylphosphonic acid |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])cc(CNCP(=O)(O)O)c2[nH]c1=O |
| InChI | InChI=1S/C10H11N4O7P/c15-9-10(16)13-8-5(3-11-4-22(19,20)21)1-6(14(17)18)2-7(8)12-9/h1-2,11H,3-4H2,(H,12,15)(H,13,16)(H2,19,20,21) |
| InChIKey | ABFMMCZFKUIJGQ-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 178.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|