About trimethyl-[3-(2,2,2-trifluoroacetyl)phenyl]azanium
trimethyl-[3-(2,2,2-trifluoroacetyl)phenyl]azanium (PubChem CID 5492) has the molecular formula C11H13F3NO+
and a molecular weight of 232.22 g/mol. Its IUPAC name is trimethyl-[3-(2,2,2-trifluoroacetyl)phenyl]azanium.
Molecular Properties
| Compound Name | trimethyl-[3-(2,2,2-trifluoroacetyl)phenyl]azanium |
| PubChem CID | 5492 |
| Molecular Formula | C11H13F3NO+ |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | trimethyl-[3-(2,2,2-trifluoroacetyl)phenyl]azanium |
| SMILES | C[N+](C)(C)c1cccc(C(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3NO/c1-15(2,3)9-6-4-5-8(7-9)10(16)11(12,13)14/h4-7H,1-3H3/q+1 |
| InChIKey | JIBZSTPMDKSJOX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[3-(2,2,2-trifluoroacetyl)phenyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[3-(2,2,2-trifluoroacetyl)phenyl]azanium?
The IUPAC name of trimethyl-[3-(2,2,2-trifluoroacetyl)phenyl]azanium (CID 5492) is trimethyl-[3-(2,2,2-trifluoroacetyl)phenyl]azanium.
What is the SMILES notation for trimethyl-[3-(2,2,2-trifluoroacetyl)phenyl]azanium?
The canonical SMILES for trimethyl-[3-(2,2,2-trifluoroacetyl)phenyl]azanium is C[N+](C)(C)c1cccc(C(=O)C(F)(F)F)c1.
What is the InChIKey of trimethyl-[3-(2,2,2-trifluoroacetyl)phenyl]azanium?
The InChIKey is JIBZSTPMDKSJOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F3NO/c1-15(2,3)9-6-4-5-8(7-9)10(16)11(12,13)14/h4-7H,1-3H3/q+1.
What are the key properties of trimethyl-[3-(2,2,2-trifluoroacetyl)phenyl]azanium?
trimethyl-[3-(2,2,2-trifluoroacetyl)phenyl]azanium has a molecular weight of 232.22 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[3-(2,2,2-trifluoroacetyl)phenyl]azanium is sourced from PubChem (CID 5492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).