C11H10ClN5 — CID 54920303
4-(7-chloro-1-methylbenzimidazol-2-yl)-1H-pyrazol-5-amine (PubChem CID 54920303) has the molecular formula C11H10ClN5 and a molecular weight of 247.69 g/mol. Its IUPAC name is 4-(7-chloro-1-methylbenzimidazol-2-yl)-1H-pyrazol-5-amine.
| Compound Name | 4-(7-chloro-1-methylbenzimidazol-2-yl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 54920303 |
| Molecular Formula | C11H10ClN5 |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 4-(7-chloro-1-methylbenzimidazol-2-yl)-1H-pyrazol-5-amine |
| SMILES | Cn1c(-c2cn[nH]c2N)nc2cccc(Cl)c21 |
| InChI | InChI=1S/C11H10ClN5/c1-17-9-7(12)3-2-4-8(9)15-11(17)6-5-14-16-10(6)13/h2-5H,1H3,(H3,13,14,16) |
| InChIKey | LGJCOHQVFACZLU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |