About N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-methylpyrazol-3-amine
N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-methylpyrazol-3-amine (PubChem CID 54921043) has the molecular formula C13H14FN3S
and a molecular weight of 263.34 g/mol. Its IUPAC name is N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-methylpyrazol-3-amine.
Molecular Properties
| Compound Name | N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-methylpyrazol-3-amine |
| PubChem CID | 54921043 |
| Molecular Formula | C13H14FN3S |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-methylpyrazol-3-amine |
| SMILES | Cn1ccc(NC2CCSc3c(F)cccc32)n1 |
| InChI | InChI=1S/C13H14FN3S/c1-17-7-5-12(16-17)15-11-6-8-18-13-9(11)3-2-4-10(13)14/h2-5,7,11H,6,8H2,1H3,(H,15,16) |
| InChIKey | TVZDLFXNEFPHQN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-methylpyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-methylpyrazol-3-amine?
The IUPAC name of N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-methylpyrazol-3-amine (CID 54921043) is N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-methylpyrazol-3-amine.
What is the SMILES notation for N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-methylpyrazol-3-amine?
The canonical SMILES for N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-methylpyrazol-3-amine is Cn1ccc(NC2CCSc3c(F)cccc32)n1.
What is the InChIKey of N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-methylpyrazol-3-amine?
The InChIKey is TVZDLFXNEFPHQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FN3S/c1-17-7-5-12(16-17)15-11-6-8-18-13-9(11)3-2-4-10(13)14/h2-5,7,11H,6,8H2,1H3,(H,15,16).
What are the key properties of N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-methylpyrazol-3-amine?
N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-methylpyrazol-3-amine has a molecular weight of 263.34 g/mol, XLogP of 3.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-methylpyrazol-3-amine is sourced from PubChem (CID 54921043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).