C48H36N4 — CID 5492157
5,10,15,20-tetrakis(4-methylphenyl)porphyrin (PubChem CID 5492157) has the molecular formula C48H36N4 and a molecular weight of 668.84 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-methylphenyl)porphyrin.
| Compound Name | 5,10,15,20-tetrakis(4-methylphenyl)porphyrin |
|---|---|
| PubChem CID | 5492157 |
| Molecular Formula | C48H36N4 |
| Molecular Weight | 668.84 g/mol |
| Exact Mass | 668.29 |
| IUPAC Name | 5,10,15,20-tetrakis(4-methylphenyl)porphyrin |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(C)cc3)=C3/C=CC(=N3)/C(c3ccc(C)cc3)=C3/C=CC(=N3)/C(c3ccc(C)cc3)=C3/C=CC2=N3)cc1 |
| InChI | InChI=1S/C48H36N4/c1-29-5-13-33(14-6-29)45-37-21-23-39(49-37)46(34-15-7-30(2)8-16-34)41-25-27-43(51-41)48(36-19-11-32(4)12-20-36)44-28-26-42(52-44)47(40-24-22-38(45)50-40)35-17-9-31(3)10-18-35/h5-28H,1-4H3/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44- |
| InChIKey | VWODZMSWQYEWBW-PJEPRTEXSA-N |
| XLogP | 10.92 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.84 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |