About 3-amino-N,N-bis(2-methoxyethyl)-1-methylpyrazole-4-sulfonamide
3-amino-N,N-bis(2-methoxyethyl)-1-methylpyrazole-4-sulfonamide (PubChem CID 54923092) has the molecular formula C10H20N4O4S
and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-amino-N,N-bis(2-methoxyethyl)-1-methylpyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 3-amino-N,N-bis(2-methoxyethyl)-1-methylpyrazole-4-sulfonamide |
| PubChem CID | 54923092 |
| Molecular Formula | C10H20N4O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-amino-N,N-bis(2-methoxyethyl)-1-methylpyrazole-4-sulfonamide |
| SMILES | COCCN(CCOC)S(=O)(=O)c1cn(C)nc1N |
| InChI | InChI=1S/C10H20N4O4S/c1-13-8-9(10(11)12-13)19(15,16)14(4-6-17-2)5-7-18-3/h8H,4-7H2,1-3H3,(H2,11,12) |
| InChIKey | CNRQIQZCNPXMOB-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-amino-N,N-bis(2-methoxyethyl)-1-methylpyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,N-bis(2-methoxyethyl)-1-methylpyrazole-4-sulfonamide?
The IUPAC name of 3-amino-N,N-bis(2-methoxyethyl)-1-methylpyrazole-4-sulfonamide (CID 54923092) is 3-amino-N,N-bis(2-methoxyethyl)-1-methylpyrazole-4-sulfonamide.
What is the SMILES notation for 3-amino-N,N-bis(2-methoxyethyl)-1-methylpyrazole-4-sulfonamide?
The canonical SMILES for 3-amino-N,N-bis(2-methoxyethyl)-1-methylpyrazole-4-sulfonamide is COCCN(CCOC)S(=O)(=O)c1cn(C)nc1N.
What is the InChIKey of 3-amino-N,N-bis(2-methoxyethyl)-1-methylpyrazole-4-sulfonamide?
The InChIKey is CNRQIQZCNPXMOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4O4S/c1-13-8-9(10(11)12-13)19(15,16)14(4-6-17-2)5-7-18-3/h8H,4-7H2,1-3H3,(H2,11,12).
What are the key properties of 3-amino-N,N-bis(2-methoxyethyl)-1-methylpyrazole-4-sulfonamide?
3-amino-N,N-bis(2-methoxyethyl)-1-methylpyrazole-4-sulfonamide has a molecular weight of 292.36 g/mol, XLogP of -0.71, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,N-bis(2-methoxyethyl)-1-methylpyrazole-4-sulfonamide is sourced from PubChem (CID 54923092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).