C14H24N2O — CID 54923443
(2E,4E)-N-piperidin-4-yl-N-propylhexa-2,4-dienamide (PubChem CID 54923443) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is (2E,4E)-N-piperidin-4-yl-N-propylhexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-piperidin-4-yl-N-propylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 54923443 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (2E,4E)-N-piperidin-4-yl-N-propylhexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)N(CCC)C1CCNCC1 |
| InChI | InChI=1S/C14H24N2O/c1-3-5-6-7-14(17)16(12-4-2)13-8-10-15-11-9-13/h3,5-7,13,15H,4,8-12H2,1-2H3/b5-3+,7-6+ |
| InChIKey | XWXZWVPCDVUGSO-TWTPFVCWSA-N |
| XLogP | 2.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|