C10H12F7NO — CID 549235
1-(2,5-dimethylpyrrolidin-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one (PubChem CID 549235) has the molecular formula C10H12F7NO and a molecular weight of 295.20 g/mol. Its IUPAC name is 1-(2,5-dimethylpyrrolidin-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one.
| Compound Name | 1-(2,5-dimethylpyrrolidin-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
|---|---|
| PubChem CID | 549235 |
| Molecular Formula | C10H12F7NO |
| Molecular Weight | 295.20 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 1-(2,5-dimethylpyrrolidin-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
| SMILES | CC1CCC(C)N1C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F7NO/c1-5-3-4-6(2)18(5)7(19)8(11,12)9(13,14)10(15,16)17/h5-6H,3-4H2,1-2H3 |
| InChIKey | JCJIFCVKFAUFEL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|