About 2-[(2-oxo-1,3-oxazolidin-5-yl)methyl-piperidin-4-ylamino]acetamide
2-[(2-oxo-1,3-oxazolidin-5-yl)methyl-piperidin-4-ylamino]acetamide (PubChem CID 54923799) has the molecular formula C11H20N4O3
and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-[(2-oxo-1,3-oxazolidin-5-yl)methyl-piperidin-4-ylamino]acetamide.
Molecular Properties
| Compound Name | 2-[(2-oxo-1,3-oxazolidin-5-yl)methyl-piperidin-4-ylamino]acetamide |
| PubChem CID | 54923799 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-[(2-oxo-1,3-oxazolidin-5-yl)methyl-piperidin-4-ylamino]acetamide |
| SMILES | NC(=O)CN(CC1CNC(=O)O1)C1CCNCC1 |
| InChI | InChI=1S/C11H20N4O3/c12-10(16)7-15(8-1-3-13-4-2-8)6-9-5-14-11(17)18-9/h8-9,13H,1-7H2,(H2,12,16)(H,14,17) |
| InChIKey | ZQZYBHOKLCMBOW-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-oxo-1,3-oxazolidin-5-yl)methyl-piperidin-4-ylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-oxo-1,3-oxazolidin-5-yl)methyl-piperidin-4-ylamino]acetamide?
The IUPAC name of 2-[(2-oxo-1,3-oxazolidin-5-yl)methyl-piperidin-4-ylamino]acetamide (CID 54923799) is 2-[(2-oxo-1,3-oxazolidin-5-yl)methyl-piperidin-4-ylamino]acetamide.
What is the SMILES notation for 2-[(2-oxo-1,3-oxazolidin-5-yl)methyl-piperidin-4-ylamino]acetamide?
The canonical SMILES for 2-[(2-oxo-1,3-oxazolidin-5-yl)methyl-piperidin-4-ylamino]acetamide is NC(=O)CN(CC1CNC(=O)O1)C1CCNCC1.
What is the InChIKey of 2-[(2-oxo-1,3-oxazolidin-5-yl)methyl-piperidin-4-ylamino]acetamide?
The InChIKey is ZQZYBHOKLCMBOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O3/c12-10(16)7-15(8-1-3-13-4-2-8)6-9-5-14-11(17)18-9/h8-9,13H,1-7H2,(H2,12,16)(H,14,17).
What are the key properties of 2-[(2-oxo-1,3-oxazolidin-5-yl)methyl-piperidin-4-ylamino]acetamide?
2-[(2-oxo-1,3-oxazolidin-5-yl)methyl-piperidin-4-ylamino]acetamide has a molecular weight of 256.31 g/mol, XLogP of -1.37, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-oxo-1,3-oxazolidin-5-yl)methyl-piperidin-4-ylamino]acetamide is sourced from PubChem (CID 54923799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).