About N-([1,2,4]triazolo[4,3-a]pyrazin-3-ylmethyl)aniline
N-([1,2,4]triazolo[4,3-a]pyrazin-3-ylmethyl)aniline (PubChem CID 54924493) has the molecular formula C12H11N5
and a molecular weight of 225.26 g/mol. Its IUPAC name is N-([1,2,4]triazolo[4,3-a]pyrazin-3-ylmethyl)aniline.
Molecular Properties
| Compound Name | N-([1,2,4]triazolo[4,3-a]pyrazin-3-ylmethyl)aniline |
| PubChem CID | 54924493 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | N-([1,2,4]triazolo[4,3-a]pyrazin-3-ylmethyl)aniline |
| SMILES | c1ccc(NCc2nnc3cnccn23)cc1 |
| InChI | InChI=1S/C12H11N5/c1-2-4-10(5-3-1)14-9-12-16-15-11-8-13-6-7-17(11)12/h1-8,14H,9H2 |
| InChIKey | CYOSVKVKTRNYLK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-([1,2,4]triazolo[4,3-a]pyrazin-3-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-([1,2,4]triazolo[4,3-a]pyrazin-3-ylmethyl)aniline?
The IUPAC name of N-([1,2,4]triazolo[4,3-a]pyrazin-3-ylmethyl)aniline (CID 54924493) is N-([1,2,4]triazolo[4,3-a]pyrazin-3-ylmethyl)aniline.
What is the SMILES notation for N-([1,2,4]triazolo[4,3-a]pyrazin-3-ylmethyl)aniline?
The canonical SMILES for N-([1,2,4]triazolo[4,3-a]pyrazin-3-ylmethyl)aniline is c1ccc(NCc2nnc3cnccn23)cc1.
What is the InChIKey of N-([1,2,4]triazolo[4,3-a]pyrazin-3-ylmethyl)aniline?
The InChIKey is CYOSVKVKTRNYLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5/c1-2-4-10(5-3-1)14-9-12-16-15-11-8-13-6-7-17(11)12/h1-8,14H,9H2.
What are the key properties of N-([1,2,4]triazolo[4,3-a]pyrazin-3-ylmethyl)aniline?
N-([1,2,4]triazolo[4,3-a]pyrazin-3-ylmethyl)aniline has a molecular weight of 225.26 g/mol, XLogP of 1.74, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-([1,2,4]triazolo[4,3-a]pyrazin-3-ylmethyl)aniline is sourced from PubChem (CID 54924493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).