C13H7ClF2N2S — CID 54924634
5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline (PubChem CID 54924634) has the molecular formula C13H7ClF2N2S and a molecular weight of 296.73 g/mol. Its IUPAC name is 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline.
| Compound Name | 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline |
|---|---|
| PubChem CID | 54924634 |
| Molecular Formula | C13H7ClF2N2S |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline |
| SMILES | Nc1cc(-c2nc3cc(Cl)ccc3s2)c(F)cc1F |
| InChI | InChI=1S/C13H7ClF2N2S/c14-6-1-2-12-11(3-6)18-13(19-12)7-4-10(17)9(16)5-8(7)15/h1-5H,17H2 |
| InChIKey | UJCIJVLVUFEDBR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|