About 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline
5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline (PubChem CID 54924634) has the molecular formula C13H7ClF2N2S
and a molecular weight of 296.73 g/mol. Its IUPAC name is 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline.
Molecular Properties
| Compound Name | 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline |
| PubChem CID | 54924634 |
| Molecular Formula | C13H7ClF2N2S |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline |
| SMILES | Nc1cc(-c2nc3cc(Cl)ccc3s2)c(F)cc1F |
| InChI | InChI=1S/C13H7ClF2N2S/c14-6-1-2-12-11(3-6)18-13(19-12)7-4-10(17)9(16)5-8(7)15/h1-5H,17H2 |
| InChIKey | UJCIJVLVUFEDBR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline?
The IUPAC name of 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline (CID 54924634) is 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline.
What is the SMILES notation for 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline?
The canonical SMILES for 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline is Nc1cc(-c2nc3cc(Cl)ccc3s2)c(F)cc1F.
What is the InChIKey of 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline?
The InChIKey is UJCIJVLVUFEDBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7ClF2N2S/c14-6-1-2-12-11(3-6)18-13(19-12)7-4-10(17)9(16)5-8(7)15/h1-5H,17H2.
What are the key properties of 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline?
5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline has a molecular weight of 296.73 g/mol, XLogP of 4.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-chloro-1,3-benzothiazol-2-yl)-2,4-difluoroaniline is sourced from PubChem (CID 54924634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).