C10H18O8S — CID 5492539
(2R,3R,4R)-2,3,5-trihydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanylpentanal (PubChem CID 5492539) has the molecular formula C10H18O8S and a molecular weight of 298.31 g/mol. Its IUPAC name is (2R,3R,4R)-2,3,5-trihydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanylpentanal.
| Compound Name | (2R,3R,4R)-2,3,5-trihydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanylpentanal |
|---|---|
| PubChem CID | 5492539 |
| Molecular Formula | C10H18O8S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (2R,3R,4R)-2,3,5-trihydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanylpentanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@@H](CO)S[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18O8S/c11-1-4(13)7(15)6(2-12)19-10-9(17)8(16)5(14)3-18-10/h1,4-10,12-17H,2-3H2/t4-,5+,6+,7+,8-,9+,10-/m0/s1 |
| InChIKey | NEGASMZGSNDEKT-RSZZQXBVSA-N |
| XLogP | -3.56 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|