About 3-[tert-butyl-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]propanoic acid
3-[tert-butyl-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]propanoic acid (PubChem CID 54926050) has the molecular formula C13H22N2O4
and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-[tert-butyl-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[tert-butyl-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]propanoic acid |
| PubChem CID | 54926050 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 3-[tert-butyl-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]propanoic acid |
| SMILES | CC(C)(C)N(CCC(=O)O)CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C13H22N2O4/c1-13(2,3)14(7-6-12(18)19)8-9-15-10(16)4-5-11(15)17/h4-9H2,1-3H3,(H,18,19) |
| InChIKey | FUYUSSBPRQTTJB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[tert-butyl-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[tert-butyl-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]propanoic acid?
The IUPAC name of 3-[tert-butyl-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]propanoic acid (CID 54926050) is 3-[tert-butyl-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]propanoic acid.
What is the SMILES notation for 3-[tert-butyl-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]propanoic acid?
The canonical SMILES for 3-[tert-butyl-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]propanoic acid is CC(C)(C)N(CCC(=O)O)CCN1C(=O)CCC1=O.
What is the InChIKey of 3-[tert-butyl-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]propanoic acid?
The InChIKey is FUYUSSBPRQTTJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O4/c1-13(2,3)14(7-6-12(18)19)8-9-15-10(16)4-5-11(15)17/h4-9H2,1-3H3,(H,18,19).
What are the key properties of 3-[tert-butyl-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]propanoic acid?
3-[tert-butyl-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]propanoic acid has a molecular weight of 270.33 g/mol, XLogP of 0.71, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[tert-butyl-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]propanoic acid is sourced from PubChem (CID 54926050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).