About N-ethyl-2,4-difluoro-6-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide
N-ethyl-2,4-difluoro-6-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide (PubChem CID 54926209) has the molecular formula C12H13F2NO3S
and a molecular weight of 289.30 g/mol. Its IUPAC name is N-ethyl-2,4-difluoro-6-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-ethyl-2,4-difluoro-6-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide |
| PubChem CID | 54926209 |
| Molecular Formula | C12H13F2NO3S |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N-ethyl-2,4-difluoro-6-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide |
| SMILES | CCN(C)S(=O)(=O)c1c(F)cc(F)cc1C#CCO |
| InChI | InChI=1S/C12H13F2NO3S/c1-3-15(2)19(17,18)12-9(5-4-6-16)7-10(13)8-11(12)14/h7-8,16H,3,6H2,1-2H3 |
| InChIKey | MFCXDWAUTLGBCH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2,4-difluoro-6-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,4-difluoro-6-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide?
The IUPAC name of N-ethyl-2,4-difluoro-6-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide (CID 54926209) is N-ethyl-2,4-difluoro-6-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide.
What is the SMILES notation for N-ethyl-2,4-difluoro-6-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide?
The canonical SMILES for N-ethyl-2,4-difluoro-6-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide is CCN(C)S(=O)(=O)c1c(F)cc(F)cc1C#CCO.
What is the InChIKey of N-ethyl-2,4-difluoro-6-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide?
The InChIKey is MFCXDWAUTLGBCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2NO3S/c1-3-15(2)19(17,18)12-9(5-4-6-16)7-10(13)8-11(12)14/h7-8,16H,3,6H2,1-2H3.
What are the key properties of N-ethyl-2,4-difluoro-6-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide?
N-ethyl-2,4-difluoro-6-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide has a molecular weight of 289.30 g/mol, XLogP of 0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,4-difluoro-6-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide is sourced from PubChem (CID 54926209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).