C11H6Cl3N3O — CID 54926951
6-chloro-N-(3,4-dichlorophenyl)pyridazine-3-carboxamide (PubChem CID 54926951) has the molecular formula C11H6Cl3N3O and a molecular weight of 302.55 g/mol. Its IUPAC name is 6-chloro-N-(3,4-dichlorophenyl)pyridazine-3-carboxamide.
| Compound Name | 6-chloro-N-(3,4-dichlorophenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 54926951 |
| Molecular Formula | C11H6Cl3N3O |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | 6-chloro-N-(3,4-dichlorophenyl)pyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C11H6Cl3N3O/c12-7-2-1-6(5-8(7)13)15-11(18)9-3-4-10(14)17-16-9/h1-5H,(H,15,18) |
| InChIKey | FBCVOWYXUWCCRQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |