About 1-acetyl-2,5-dihydropyrrole-2-carboxylic acid
1-acetyl-2,5-dihydropyrrole-2-carboxylic acid (PubChem CID 549281) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is 1-acetyl-2,5-dihydropyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-acetyl-2,5-dihydropyrrole-2-carboxylic acid |
| PubChem CID | 549281 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 1-acetyl-2,5-dihydropyrrole-2-carboxylic acid |
| SMILES | CC(=O)N1CC=CC1C(=O)O |
| InChI | InChI=1S/C7H9NO3/c1-5(9)8-4-2-3-6(8)7(10)11/h2-3,6H,4H2,1H3,(H,10,11) |
| InChIKey | VBHKUSGNBBQVID-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-acetyl-2,5-dihydropyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-2,5-dihydropyrrole-2-carboxylic acid?
The IUPAC name of 1-acetyl-2,5-dihydropyrrole-2-carboxylic acid (CID 549281) is 1-acetyl-2,5-dihydropyrrole-2-carboxylic acid.
What is the SMILES notation for 1-acetyl-2,5-dihydropyrrole-2-carboxylic acid?
The canonical SMILES for 1-acetyl-2,5-dihydropyrrole-2-carboxylic acid is CC(=O)N1CC=CC1C(=O)O.
What is the InChIKey of 1-acetyl-2,5-dihydropyrrole-2-carboxylic acid?
The InChIKey is VBHKUSGNBBQVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c1-5(9)8-4-2-3-6(8)7(10)11/h2-3,6H,4H2,1H3,(H,10,11).
What are the key properties of 1-acetyl-2,5-dihydropyrrole-2-carboxylic acid?
1-acetyl-2,5-dihydropyrrole-2-carboxylic acid has a molecular weight of 155.15 g/mol, XLogP of -0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-2,5-dihydropyrrole-2-carboxylic acid is sourced from PubChem (CID 549281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).