C14H27N3O — CID 54928683
2-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)hexanamide (PubChem CID 54928683) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)hexanamide.
| Compound Name | 2-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)hexanamide |
|---|---|
| PubChem CID | 54928683 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 2-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)hexanamide |
| SMILES | CCCCC(N)C(=O)NC1CCN2CCCCC12 |
| InChI | InChI=1S/C14H27N3O/c1-2-3-6-11(15)14(18)16-12-8-10-17-9-5-4-7-13(12)17/h11-13H,2-10,15H2,1H3,(H,16,18) |
| InChIKey | OUCZMOSSVBNXTD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |