About 5-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-4-sulfonamide
5-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-4-sulfonamide (PubChem CID 54930114) has the molecular formula C10H15N5O2S
and a molecular weight of 269.33 g/mol. Its IUPAC name is 5-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 5-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-4-sulfonamide |
| PubChem CID | 54930114 |
| Molecular Formula | C10H15N5O2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 5-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)c(C)c1NS(=O)(=O)c1cn[nH]c1C |
| InChI | InChI=1S/C10H15N5O2S/c1-6-9(5-11-12-6)18(16,17)14-10-7(2)13-15(4)8(10)3/h5,14H,1-4H3,(H,11,12) |
| InChIKey | MGWOOCAHLILENR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-4-sulfonamide?
The IUPAC name of 5-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-4-sulfonamide (CID 54930114) is 5-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for 5-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-4-sulfonamide?
The canonical SMILES for 5-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-4-sulfonamide is Cc1nn(C)c(C)c1NS(=O)(=O)c1cn[nH]c1C.
What is the InChIKey of 5-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-4-sulfonamide?
The InChIKey is MGWOOCAHLILENR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O2S/c1-6-9(5-11-12-6)18(16,17)14-10-7(2)13-15(4)8(10)3/h5,14H,1-4H3,(H,11,12).
What are the key properties of 5-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-4-sulfonamide?
5-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-4-sulfonamide has a molecular weight of 269.33 g/mol, XLogP of 0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(1,3,5-trimethylpyrazol-4-yl)-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 54930114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).