C11H10N4O2S — CID 54930145
N-(2-cyanophenyl)-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 54930145) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is N-(2-cyanophenyl)-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(2-cyanophenyl)-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 54930145 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | N-(2-cyanophenyl)-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C11H10N4O2S/c1-8-11(7-13-14-8)18(16,17)15-10-5-3-2-4-9(10)6-12/h2-5,7,15H,1H3,(H,13,14) |
| InChIKey | PXQJNLSRYOCNBQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |