C13H16N2O3 — CID 54930681
2-[3-methoxy-2-(1,2-oxazol-4-ylmethoxy)phenyl]ethanamine (PubChem CID 54930681) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[3-methoxy-2-(1,2-oxazol-4-ylmethoxy)phenyl]ethanamine.
| Compound Name | 2-[3-methoxy-2-(1,2-oxazol-4-ylmethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 54930681 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-[3-methoxy-2-(1,2-oxazol-4-ylmethoxy)phenyl]ethanamine |
| SMILES | COc1cccc(CCN)c1OCc1cnoc1 |
| InChI | InChI=1S/C13H16N2O3/c1-16-12-4-2-3-11(5-6-14)13(12)17-8-10-7-15-18-9-10/h2-4,7,9H,5-6,8,14H2,1H3 |
| InChIKey | ATBUQGXZCBYKPC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |