C14H17NO2S — CID 54931143
2-[5-methoxy-2-(thiophen-2-ylmethoxy)phenyl]ethanamine (PubChem CID 54931143) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-[5-methoxy-2-(thiophen-2-ylmethoxy)phenyl]ethanamine.
| Compound Name | 2-[5-methoxy-2-(thiophen-2-ylmethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 54931143 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-[5-methoxy-2-(thiophen-2-ylmethoxy)phenyl]ethanamine |
| SMILES | COc1ccc(OCc2cccs2)c(CCN)c1 |
| InChI | InChI=1S/C14H17NO2S/c1-16-12-4-5-14(11(9-12)6-7-15)17-10-13-3-2-8-18-13/h2-5,8-9H,6-7,10,15H2,1H3 |
| InChIKey | KNOIYWSIWRMXFS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |