C16H22N2 — CID 54931681
3-[1-(2-cyclopentylethylamino)ethyl]benzonitrile (PubChem CID 54931681) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 3-[1-(2-cyclopentylethylamino)ethyl]benzonitrile.
| Compound Name | 3-[1-(2-cyclopentylethylamino)ethyl]benzonitrile |
|---|---|
| PubChem CID | 54931681 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 3-[1-(2-cyclopentylethylamino)ethyl]benzonitrile |
| SMILES | CC(NCCC1CCCC1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C16H22N2/c1-13(16-8-4-7-15(11-16)12-17)18-10-9-14-5-2-3-6-14/h4,7-8,11,13-14,18H,2-3,5-6,9-10H2,1H3 |
| InChIKey | PANBZVCMNBYBPA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |