About 4-[(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)amino]butanamide
4-[(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)amino]butanamide (PubChem CID 54933396) has the molecular formula C9H15N5O3
and a molecular weight of 241.25 g/mol. Its IUPAC name is 4-[(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)amino]butanamide.
Molecular Properties
| Compound Name | 4-[(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)amino]butanamide |
| PubChem CID | 54933396 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-[(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)amino]butanamide |
| SMILES | Cn1c(N)c(NCCCC(N)=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H15N5O3/c1-14-7(11)6(8(16)13-9(14)17)12-4-2-3-5(10)15/h12H,2-4,11H2,1H3,(H2,10,15)(H,13,16,17) |
| InChIKey | TVPVTLHPWYCXMJ-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)amino]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)amino]butanamide?
The IUPAC name of 4-[(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)amino]butanamide (CID 54933396) is 4-[(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)amino]butanamide.
What is the SMILES notation for 4-[(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)amino]butanamide?
The canonical SMILES for 4-[(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)amino]butanamide is Cn1c(N)c(NCCCC(N)=O)c(=O)[nH]c1=O.
What is the InChIKey of 4-[(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)amino]butanamide?
The InChIKey is TVPVTLHPWYCXMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O3/c1-14-7(11)6(8(16)13-9(14)17)12-4-2-3-5(10)15/h12H,2-4,11H2,1H3,(H2,10,15)(H,13,16,17).
What are the key properties of 4-[(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)amino]butanamide?
4-[(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)amino]butanamide has a molecular weight of 241.25 g/mol, XLogP of -1.67, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)amino]butanamide is sourced from PubChem (CID 54933396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).